C9H13ClN2 — CID 144669703
(4E,5E)-5-(2-chloropropylidene)-4-ethylidene-1-methylimidazole (PubChem CID 144669703) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is (4E,5E)-5-(2-chloropropylidene)-4-ethylidene-1-methylimidazole.
| Compound Name | (4E,5E)-5-(2-chloropropylidene)-4-ethylidene-1-methylimidazole |
|---|---|
| PubChem CID | 144669703 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (4E,5E)-5-(2-chloropropylidene)-4-ethylidene-1-methylimidazole |
| SMILES | C/C=c1/ncn(C)/c1=C/C(C)Cl |
| InChI | InChI=1S/C9H13ClN2/c1-4-8-9(5-7(2)10)12(3)6-11-8/h4-7H,1-3H3/b8-4+,9-5+ |
| InChIKey | NSRDIZGNMFUXBY-KBXRYBNXSA-N |
| XLogP | 0.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|