About N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane
N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane (PubChem CID 144672572) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane.
Molecular Properties
| Compound Name | N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane |
| PubChem CID | 144672572 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane |
| SMILES | C.CC.CC.[H]/N=C(\C=C)N(C=C)/C=C\CC |
| InChI | InChI=1S/C9H14N2.2C2H6.CH4/c1-4-7-8-11(6-3)9(10)5-2;2*1-2;/h5-8,10H,2-4H2,1H3;2*1-2H3;1H4/b8-7-,10-9+;;; |
| InChIKey | YWFMJYSPIGSCGD-VVFQFCECSA-N |
| XLogP | 5.21 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane?
The IUPAC name of N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane (CID 144672572) is N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane.
What is the SMILES notation for N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane?
The canonical SMILES for N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane is C.CC.CC.[H]/N=C(\C=C)N(C=C)/C=C\CC.
What is the InChIKey of N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane?
The InChIKey is YWFMJYSPIGSCGD-VVFQFCECSA-N. The full InChI is InChI=1S/C9H14N2.2C2H6.CH4/c1-4-7-8-11(6-3)9(10)5-2;2*1-2;/h5-8,10H,2-4H2,1H3;2*1-2H3;1H4/b8-7-,10-9+;;;.
What are the key properties of N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane?
N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane has a molecular weight of 226.41 g/mol, XLogP of 5.21, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-1-enyl]-N-ethenylprop-2-enimidamide;ethane;methane is sourced from PubChem (CID 144672572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).