C18H16BrNO3 — CID 144673436
5-(Bromomethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole (PubChem CID 144673436) has the molecular formula C18H16BrNO3 and a molecular weight of 374.20 g/mol. Its IUPAC name is 5-(bromomethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole.
| Compound Name | 5-(Bromomethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 144673436 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 5-(bromomethyl)-3,4-bis(4-methoxyphenyl)-1,2-oxazole |
| SMILES | COC1=CC=C(C=C1)C2=C(ON=C2C3=CC=C(C=C3)OC)CBr |
| InChI | InChI=1S/C18H16BrNO3/c1-21-14-7-3-12(4-8-14)17-16(11-19)23-20-18(17)13-5-9-15(22-2)10-6-13/h3-10H,11H2,1-2H3 |
| InChIKey | ZGXAXMFPKWHSLB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | 354 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|