About CID 144674125
CID 144674125 (PubChem CID 144674125) has the molecular formula C25H21B6N3O5
and a molecular weight of 508.33 g/mol.
Molecular Properties
| Compound Name | CID 144674125 |
| PubChem CID | 144674125 |
| Molecular Formula | C25H21B6N3O5 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C([B])([B])Oc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc([B])c1C([B])([B])N1CCOCC1 |
| InChI | InChI=1S/C25H21B6N3O5/c26-16-10-13(11-17(27)21(16)24(28,29)33-6-8-38-9-7-33)25(30,31)39-19-3-1-2-14-15(19)12-34(23(14)37)18-4-5-20(35)32-22(18)36/h1-3,10-11,18H,4-9,12H2,(H,32,35,36) |
| InChIKey | YXXSFNAEPKNERW-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 144674125 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144674125?
The IUPAC name of CID 144674125 (CID 144674125) is not available.
What is the SMILES notation for CID 144674125?
The canonical SMILES for CID 144674125 is [B]c1cc(C([B])([B])Oc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc([B])c1C([B])([B])N1CCOCC1.
What is the InChIKey of CID 144674125?
The InChIKey is YXXSFNAEPKNERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21B6N3O5/c26-16-10-13(11-17(27)21(16)24(28,29)33-6-8-38-9-7-33)25(30,31)39-19-3-1-2-14-15(19)12-34(23(14)37)18-4-5-20(35)32-22(18)36/h1-3,10-11,18H,4-9,12H2,(H,32,35,36).
What are the key properties of CID 144674125?
CID 144674125 has a molecular weight of 508.33 g/mol, XLogP of -2.66, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144674125 is sourced from PubChem (CID 144674125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).