About (4-amino-2-chlorophenyl) thiohypofluorite
(4-amino-2-chlorophenyl) thiohypofluorite (PubChem CID 144675924) has the molecular formula C6H5ClFNS
and a molecular weight of 177.63 g/mol. Its IUPAC name is (4-amino-2-chlorophenyl) thiohypofluorite.
Molecular Properties
| Compound Name | (4-amino-2-chlorophenyl) thiohypofluorite |
| PubChem CID | 144675924 |
| Molecular Formula | C6H5ClFNS |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 176.98 |
| IUPAC Name | (4-amino-2-chlorophenyl) thiohypofluorite |
| SMILES | Nc1ccc(SF)c(Cl)c1 |
| InChI | InChI=1S/C6H5ClFNS/c7-5-3-4(9)1-2-6(5)10-8/h1-3H,9H2 |
| InChIKey | VNVAJTOPYNJEMB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2-chlorophenyl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-chlorophenyl) thiohypofluorite?
The IUPAC name of (4-amino-2-chlorophenyl) thiohypofluorite (CID 144675924) is (4-amino-2-chlorophenyl) thiohypofluorite.
What is the SMILES notation for (4-amino-2-chlorophenyl) thiohypofluorite?
The canonical SMILES for (4-amino-2-chlorophenyl) thiohypofluorite is Nc1ccc(SF)c(Cl)c1.
What is the InChIKey of (4-amino-2-chlorophenyl) thiohypofluorite?
The InChIKey is VNVAJTOPYNJEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClFNS/c7-5-3-4(9)1-2-6(5)10-8/h1-3H,9H2.
What are the key properties of (4-amino-2-chlorophenyl) thiohypofluorite?
(4-amino-2-chlorophenyl) thiohypofluorite has a molecular weight of 177.63 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-chlorophenyl) thiohypofluorite is sourced from PubChem (CID 144675924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).