C8H11F4N3 — CID 144676313
N-[(1E,3E)-4-amino-2-(fluoromethyl)buta-1,3-dienyl]-N'-(2,2,2-trifluoroethyl)methanimidamide (PubChem CID 144676313) has the molecular formula C8H11F4N3 and a molecular weight of 225.19 g/mol. Its IUPAC name is N-[(1E,3E)-4-amino-2-(fluoromethyl)buta-1,3-dienyl]-N'-(2,2,2-trifluoroethyl)methanimidamide.
| Compound Name | N-[(1E,3E)-4-amino-2-(fluoromethyl)buta-1,3-dienyl]-N'-(2,2,2-trifluoroethyl)methanimidamide |
|---|---|
| PubChem CID | 144676313 |
| Molecular Formula | C8H11F4N3 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-[(1E,3E)-4-amino-2-(fluoromethyl)buta-1,3-dienyl]-N'-(2,2,2-trifluoroethyl)methanimidamide |
| SMILES | N/C=C/C(=C\N/C=N/CC(F)(F)F)CF |
| InChI | InChI=1S/C8H11F4N3/c9-3-7(1-2-13)4-14-6-15-5-8(10,11)12/h1-2,4,6H,3,5,13H2,(H,14,15)/b2-1+,7-4+ |
| InChIKey | PHXMZWWUHFKSKB-SLWFWGMUSA-N |
| XLogP | 1.49 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|