C9H15FN2 — CID 142309219
N'-ethyl-N-[(1Z,3E)-5-fluoro-3-methylpenta-1,3-dienyl]methanimidamide (PubChem CID 142309219) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is N'-ethyl-N-[(1Z,3E)-5-fluoro-3-methylpenta-1,3-dienyl]methanimidamide.
| Compound Name | N'-ethyl-N-[(1Z,3E)-5-fluoro-3-methylpenta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 142309219 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N'-ethyl-N-[(1Z,3E)-5-fluoro-3-methylpenta-1,3-dienyl]methanimidamide |
| SMILES | CC/N=C/N/C=C\C(C)=C\CF |
| InChI | InChI=1S/C9H15FN2/c1-3-11-8-12-7-5-9(2)4-6-10/h4-5,7-8H,3,6H2,1-2H3,(H,11,12)/b7-5-,9-4+ |
| InChIKey | QQHJSELYMOQNRJ-YQDRFQIPSA-N |
| XLogP | 2.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|