C27H34N2O5S — CID 144676524
2-[2-(cyclohexylmethyl)-6,9-dimethyl-7-(4-methylphenyl)-1,1-dioxo-3a,4-dihydro-3H-[1,2,5]thiadiazolo[3,2-c][1,4]benzoxazin-8-yl]acetic acid (PubChem CID 144676524) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is 2-[2-(cyclohexylmethyl)-6,9-dimethyl-7-(4-methylphenyl)-1,1-dioxo-3a,4-dihydro-3H-[1,2,5]thiadiazolo[3,2-c][1,4]benzoxazin-8-yl]acetic acid.
| Compound Name | 2-[2-(cyclohexylmethyl)-6,9-dimethyl-7-(4-methylphenyl)-1,1-dioxo-3a,4-dihydro-3H-[1,2,5]thiadiazolo[3,2-c][1,4]benzoxazin-8-yl]acetic acid |
|---|---|
| PubChem CID | 144676524 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-[2-(cyclohexylmethyl)-6,9-dimethyl-7-(4-methylphenyl)-1,1-dioxo-3a,4-dihydro-3H-[1,2,5]thiadiazolo[3,2-c][1,4]benzoxazin-8-yl]acetic acid |
| SMILES | Cc1ccc(-c2c(C)c3c(c(C)c2CC(=O)O)N2C(CO3)CN(CC3CCCCC3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C27H34N2O5S/c1-17-9-11-21(12-10-17)25-19(3)27-26(18(2)23(25)13-24(30)31)29-22(16-34-27)15-28(35(29,32)33)14-20-7-5-4-6-8-20/h9-12,20,22H,4-8,13-16H2,1-3H3,(H,30,31) |
| InChIKey | INNKASNRFSDVAR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |