C20H23NO5S — CID 146207661
2-[7,10-dimethyl-8-(4-methylphenyl)-2,2-dioxo-1,3,4,5-tetrahydro-6,2λ6,1-benzoxathiazocin-9-yl]acetic acid (PubChem CID 146207661) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-[7,10-dimethyl-8-(4-methylphenyl)-2,2-dioxo-1,3,4,5-tetrahydro-6,2λ6,1-benzoxathiazocin-9-yl]acetic acid.
| Compound Name | 2-[7,10-dimethyl-8-(4-methylphenyl)-2,2-dioxo-1,3,4,5-tetrahydro-6,2λ6,1-benzoxathiazocin-9-yl]acetic acid |
|---|---|
| PubChem CID | 146207661 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[7,10-dimethyl-8-(4-methylphenyl)-2,2-dioxo-1,3,4,5-tetrahydro-6,2λ6,1-benzoxathiazocin-9-yl]acetic acid |
| SMILES | Cc1ccc(-c2c(C)c3c(c(C)c2CC(=O)O)NS(=O)(=O)CCCO3)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-12-5-7-15(8-6-12)18-14(3)20-19(13(2)16(18)11-17(22)23)21-27(24,25)10-4-9-26-20/h5-8,21H,4,9-11H2,1-3H3,(H,22,23) |
| InChIKey | IMPONXBRLHHASL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |