C21H28N2O4S2 — CID 144677046
[3-formyl-5-(3-phenylpropyl)-1,2-oxazol-4-yl]methoxymethanedithioic acid;N-methyl-1-(oxolan-3-yl)methanamine (PubChem CID 144677046) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is [3-formyl-5-(3-phenylpropyl)-1,2-oxazol-4-yl]methoxymethanedithioic acid;N-methyl-1-(oxolan-3-yl)methanamine.
| Compound Name | [3-formyl-5-(3-phenylpropyl)-1,2-oxazol-4-yl]methoxymethanedithioic acid;N-methyl-1-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 144677046 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [3-formyl-5-(3-phenylpropyl)-1,2-oxazol-4-yl]methoxymethanedithioic acid;N-methyl-1-(oxolan-3-yl)methanamine |
| SMILES | CNCC1CCOC1.O=Cc1noc(CCCc2ccccc2)c1COC(=S)S |
| InChI | InChI=1S/C15H15NO3S2.C6H13NO/c17-9-13-12(10-18-15(20)21)14(19-16-13)8-4-7-11-5-2-1-3-6-11;1-7-4-6-2-3-8-5-6/h1-3,5-6,9H,4,7-8,10H2,(H,20,21);6-7H,2-5H2,1H3 |
| InChIKey | JYMIQTFXTVXNIY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|