C23H24N2O4 — CID 90325773
4-formyl-5-(3-naphthalen-2-ylpropyl)-N-(oxolan-3-ylmethyl)-1,2-oxazole-3-carboxamide (PubChem CID 90325773) has the molecular formula C23H24N2O4 and a molecular weight of 392.45 g/mol. Its IUPAC name is 4-formyl-5-(3-naphthalen-2-ylpropyl)-N-(oxolan-3-ylmethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 4-formyl-5-(3-naphthalen-2-ylpropyl)-N-(oxolan-3-ylmethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90325773 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-formyl-5-(3-naphthalen-2-ylpropyl)-N-(oxolan-3-ylmethyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=Cc1c(C(=O)NCC2CCOC2)noc1CCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H24N2O4/c26-14-20-21(29-25-22(20)23(27)24-13-17-10-11-28-15-17)7-3-4-16-8-9-18-5-1-2-6-19(18)12-16/h1-2,5-6,8-9,12,14,17H,3-4,7,10-11,13,15H2,(H,24,27) |
| InChIKey | RXFWHKKAXJPJCI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|