C15H30N4O4 — CID 144678652
ethane;N-(3-hydroxy-1-oxobutan-2-yl)-2-(3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetamide;methanamine (PubChem CID 144678652) has the molecular formula C15H30N4O4 and a molecular weight of 330.43 g/mol. Its IUPAC name is ethane;N-(3-hydroxy-1-oxobutan-2-yl)-2-(3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetamide;methanamine.
| Compound Name | ethane;N-(3-hydroxy-1-oxobutan-2-yl)-2-(3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetamide;methanamine |
|---|---|
| PubChem CID | 144678652 |
| Molecular Formula | C15H30N4O4 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | ethane;N-(3-hydroxy-1-oxobutan-2-yl)-2-(3-oxo-2,5-diazaspiro[3.4]octan-2-yl)acetamide;methanamine |
| SMILES | CC.CC(O)C(C=O)NC(=O)CN1CC2(CCCN2)C1=O.CN |
| InChI | InChI=1S/C12H19N3O4.C2H6.CH5N/c1-8(17)9(6-16)14-10(18)5-15-7-12(11(15)19)3-2-4-13-12;2*1-2/h6,8-9,13,17H,2-5,7H2,1H3,(H,14,18);1-2H3;2H2,1H3 |
| InChIKey | RVUJGQXDKSWBJQ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|