C8H13NS2 — CID 144683266
N-[(1Z)-1-ethylsulfanyl-2-methylsulfanylbuta-1,3-dienyl]methanimine (PubChem CID 144683266) has the molecular formula C8H13NS2 and a molecular weight of 187.33 g/mol. Its IUPAC name is N-[(1Z)-1-ethylsulfanyl-2-methylsulfanylbuta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z)-1-ethylsulfanyl-2-methylsulfanylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 144683266 |
| Molecular Formula | C8H13NS2 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | N-[(1Z)-1-ethylsulfanyl-2-methylsulfanylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C(SC)=C(\N=C)SCC |
| InChI | InChI=1S/C8H13NS2/c1-5-7(10-4)8(9-3)11-6-2/h5H,1,3,6H2,2,4H3/b8-7- |
| InChIKey | SQXYXMRLIKHGLL-FPLPWBNLSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|