C9H17NS — CID 163301266
ethane;N-[(1E)-1-ethylsulfanylbuta-1,3-dienyl]methanimine (PubChem CID 163301266) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is ethane;N-[(1E)-1-ethylsulfanylbuta-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1E)-1-ethylsulfanylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 163301266 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | ethane;N-[(1E)-1-ethylsulfanylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)SCC.CC |
| InChI | InChI=1S/C7H11NS.C2H6/c1-4-6-7(8-3)9-5-2;1-2/h4,6H,1,3,5H2,2H3;1-2H3/b7-6+; |
| InChIKey | QCNVSRGRNFPDME-UHDJGPCESA-N |
| XLogP | 3.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|