C14H18FN3O — CID 144683850
N-[(3R,4S)-5-cyano-4-methylhexan-3-yl]-2-fluoropyridine-4-carboxamide (PubChem CID 144683850) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[(3R,4S)-5-cyano-4-methylhexan-3-yl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[(3R,4S)-5-cyano-4-methylhexan-3-yl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 144683850 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[(3R,4S)-5-cyano-4-methylhexan-3-yl]-2-fluoropyridine-4-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1ccnc(F)c1)[C@@H](C)C(C)C#N |
| InChI | InChI=1S/C14H18FN3O/c1-4-12(10(3)9(2)8-16)18-14(19)11-5-6-17-13(15)7-11/h5-7,9-10,12H,4H2,1-3H3,(H,18,19)/t9?,10-,12+/m0/s1 |
| InChIKey | QXGONKSEXULCAX-OJBNZGHXSA-N |
| XLogP | 2.52 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|