C17H15N5O6 — CID 144684073
acetonitrile;5-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]pyridine-2-carboxylic acid (PubChem CID 144684073) has the molecular formula C17H15N5O6 and a molecular weight of 385.34 g/mol. Its IUPAC name is acetonitrile;5-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]pyridine-2-carboxylic acid.
| Compound Name | acetonitrile;5-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 144684073 |
| Molecular Formula | C17H15N5O6 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | acetonitrile;5-[[2-[(4-nitrobenzoyl)amino]acetyl]amino]pyridine-2-carboxylic acid |
| SMILES | CC#N.O=C(CNC(=O)c1ccc([N+](=O)[O-])cc1)Nc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C15H12N4O6.C2H3N/c20-13(18-10-3-6-12(15(22)23)16-7-10)8-17-14(21)9-1-4-11(5-2-9)19(24)25;1-2-3/h1-7H,8H2,(H,17,21)(H,18,20)(H,22,23);1H3 |
| InChIKey | BEZCGQPHXMYBLO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|