C16H26N2O4 — CID 144684417
tert-butyl N-methylcarbamate;N-(2-propoxyphenyl)formamide (PubChem CID 144684417) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;N-(2-propoxyphenyl)formamide.
| Compound Name | tert-butyl N-methylcarbamate;N-(2-propoxyphenyl)formamide |
|---|---|
| PubChem CID | 144684417 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl N-methylcarbamate;N-(2-propoxyphenyl)formamide |
| SMILES | CCCOc1ccccc1NC=O.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H13NO2.C6H13NO2/c1-2-7-13-10-6-4-3-5-9(10)11-8-12;1-6(2,3)9-5(8)7-4/h3-6,8H,2,7H2,1H3,(H,11,12);1-4H3,(H,7,8) |
| InChIKey | ZRBODYYUZNVWIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|