C15H22N2O3S — CID 135192025
tert-butyl N-[(2R)-1-(2-formamidophenyl)sulfanylpropan-2-yl]carbamate (PubChem CID 135192025) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(2-formamidophenyl)sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(2-formamidophenyl)sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 135192025 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl N-[(2R)-1-(2-formamidophenyl)sulfanylpropan-2-yl]carbamate |
| SMILES | C[C@H](CSc1ccccc1NC=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O3S/c1-11(17-14(19)20-15(2,3)4)9-21-13-8-6-5-7-12(13)16-10-18/h5-8,10-11H,9H2,1-4H3,(H,16,18)(H,17,19)/t11-/m1/s1 |
| InChIKey | NGMBKEDCAXGISF-LLVKDONJSA-N |
| XLogP | 3.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|