C22H22N4O3 — CID 144686366
6-[3-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxypropyl]piperidin-2-one (PubChem CID 144686366) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-[3-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxypropyl]piperidin-2-one.
| Compound Name | 6-[3-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxypropyl]piperidin-2-one |
|---|---|
| PubChem CID | 144686366 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 6-[3-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxypropyl]piperidin-2-one |
| SMILES | O=C1CCCC(CCCOc2ccc3ncc(-c4cc5ccccc5o4)n3n2)N1 |
| InChI | InChI=1S/C22H22N4O3/c27-21-9-3-6-16(24-21)7-4-12-28-22-11-10-20-23-14-17(26(20)25-22)19-13-15-5-1-2-8-18(15)29-19/h1-2,5,8,10-11,13-14,16H,3-4,6-7,9,12H2,(H,24,27) |
| InChIKey | LDTMTIFORIIWOV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|