C19H20N4O2 — CID 71077181
N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]propan-1-amine (PubChem CID 71077181) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]propan-1-amine.
| Compound Name | N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 71077181 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]propan-1-amine |
| SMILES | CCCNCCOc1ccc2ncc(-c3cc4ccccc4o3)n2n1 |
| InChI | InChI=1S/C19H20N4O2/c1-2-9-20-10-11-24-19-8-7-18-21-13-15(23(18)22-19)17-12-14-5-3-4-6-16(14)25-17/h3-8,12-13,20H,2,9-11H2,1H3 |
| InChIKey | WIXRFOIFUVIVNG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|