C18H18N4O3 — CID 71077227
2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxy-2-(ethylamino)ethanol (PubChem CID 71077227) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxy-2-(ethylamino)ethanol.
| Compound Name | 2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxy-2-(ethylamino)ethanol |
|---|---|
| PubChem CID | 71077227 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxy-2-(ethylamino)ethanol |
| SMILES | CCNC(CO)Oc1ccc2ncc(-c3cc4ccccc4o3)n2n1 |
| InChI | InChI=1S/C18H18N4O3/c1-2-19-18(11-23)25-17-8-7-16-20-10-13(22(16)21-17)15-9-12-5-3-4-6-14(12)24-15/h3-10,18-19,23H,2,11H2,1H3 |
| InChIKey | ZHNQONMPTRIQIL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|