C24H20N4O3 — CID 90368822
N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]-2-methylbenzamide (PubChem CID 90368822) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]-2-methylbenzamide.
| Compound Name | N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 90368822 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[2-[3-(1-benzofuran-2-yl)imidazo[1,2-b]pyridazin-6-yl]oxyethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NCCOc1ccc2ncc(-c3cc4ccccc4o3)n2n1 |
| InChI | InChI=1S/C24H20N4O3/c1-16-6-2-4-8-18(16)24(29)25-12-13-30-23-11-10-22-26-15-19(28(22)27-23)21-14-17-7-3-5-9-20(17)31-21/h2-11,14-15H,12-13H2,1H3,(H,25,29) |
| InChIKey | PFBCQRSXSICZPQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|