C56H41N — CID 144687074
(3Z,7Z)-2-[9,10-bis(4-naphthalen-1-ylphenyl)anthracen-2-yl]-6-methylidenenona-1,3,7-trien-5-imine (PubChem CID 144687074) has the molecular formula C56H41N and a molecular weight of 727.95 g/mol. Its IUPAC name is (3Z,7Z)-2-[9,10-bis(4-naphthalen-1-ylphenyl)anthracen-2-yl]-6-methylidenenona-1,3,7-trien-5-imine.
| Compound Name | (3Z,7Z)-2-[9,10-bis(4-naphthalen-1-ylphenyl)anthracen-2-yl]-6-methylidenenona-1,3,7-trien-5-imine |
|---|---|
| PubChem CID | 144687074 |
| Molecular Formula | C56H41N |
| Molecular Weight | 727.95 g/mol |
| Exact Mass | 727.32 |
| IUPAC Name | (3Z,7Z)-2-[9,10-bis(4-naphthalen-1-ylphenyl)anthracen-2-yl]-6-methylidenenona-1,3,7-trien-5-imine |
| SMILES | [H]N=C(/C=C\C(=C)c1ccc2c(-c3ccc(-c4cccc5ccccc45)cc3)c3ccccc3c(-c3ccc(-c4cccc5ccccc45)cc3)c2c1)C(=C)/C=C\C |
| InChI | InChI=1S/C56H41N/c1-4-13-38(3)54(57)35-24-37(2)45-33-34-52-53(36-45)56(44-31-27-42(28-32-44)49-23-12-17-40-15-6-8-19-47(40)49)51-21-10-9-20-50(51)55(52)43-29-25-41(26-30-43)48-22-11-16-39-14-5-7-18-46(39)48/h4-36,57H,2-3H2,1H3/b13-4-,35-24-,57-54- |
| InChIKey | DRLKYSBHPHLPNI-XNXLLIHMSA-N |
| XLogP | 15.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.95 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|