C24H27Cl2NO2 — CID 144688353
6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(cyclobutylmethyl)morpholin-3-one;prop-1-ene (PubChem CID 144688353) has the molecular formula C24H27Cl2NO2 and a molecular weight of 432.39 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(cyclobutylmethyl)morpholin-3-one;prop-1-ene.
| Compound Name | 6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(cyclobutylmethyl)morpholin-3-one;prop-1-ene |
|---|---|
| PubChem CID | 144688353 |
| Molecular Formula | C24H27Cl2NO2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(cyclobutylmethyl)morpholin-3-one;prop-1-ene |
| SMILES | C=CC.O=C1COC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N1CC1CCC1 |
| InChI | InChI=1S/C21H21Cl2NO2.C3H6/c22-17-9-7-15(8-10-17)20-21(16-5-2-6-18(23)11-16)26-13-19(25)24(20)12-14-3-1-4-14;1-3-2/h2,5-11,14,20-21H,1,3-4,12-13H2;3H,1H2,2H3 |
| InChIKey | JHVWPPIGYPFRPJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|