C24H26ClNO2 — CID 123623698
6-(3-chlorophenyl)-4-(cyclopropylmethyl)-5-(4-methylphenyl)-2-prop-2-enylmorpholin-3-one (PubChem CID 123623698) has the molecular formula C24H26ClNO2 and a molecular weight of 395.93 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-4-(cyclopropylmethyl)-5-(4-methylphenyl)-2-prop-2-enylmorpholin-3-one.
| Compound Name | 6-(3-chlorophenyl)-4-(cyclopropylmethyl)-5-(4-methylphenyl)-2-prop-2-enylmorpholin-3-one |
|---|---|
| PubChem CID | 123623698 |
| Molecular Formula | C24H26ClNO2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 6-(3-chlorophenyl)-4-(cyclopropylmethyl)-5-(4-methylphenyl)-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CCC1OC(c2cccc(Cl)c2)C(c2ccc(C)cc2)N(CC2CC2)C1=O |
| InChI | InChI=1S/C24H26ClNO2/c1-3-5-21-24(27)26(15-17-10-11-17)22(18-12-8-16(2)9-13-18)23(28-21)19-6-4-7-20(25)14-19/h3-4,6-9,12-14,17,21-23H,1,5,10-11,15H2,2H3 |
| InChIKey | RHGUXWAREGLRMR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|