C18H18O6 — CID 144689591
1-cyclohexa-1,5-dien-1-yl-4-(5,6-dihydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butane-1,4-dione (PubChem CID 144689591) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-(5,6-dihydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butane-1,4-dione.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-(5,6-dihydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 144689591 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-(5,6-dihydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1cc2c(c(O)c1O)OCCO2)C1=CCCC=C1 |
| InChI | InChI=1S/C18H18O6/c19-13(11-4-2-1-3-5-11)6-7-14(20)12-10-15-18(17(22)16(12)21)24-9-8-23-15/h2,4-5,10,21-22H,1,3,6-9H2 |
| InChIKey | CYCPFYKUJBQPRG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|