C23H22F3N3O5 — CID 144691112
(3R,6R)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144691112) has the molecular formula C23H22F3N3O5 and a molecular weight of 477.44 g/mol. Its IUPAC name is (3R,6R)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6R)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144691112 |
| Molecular Formula | C23H22F3N3O5 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (3R,6R)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1COC2C1OC[C@H]2Oc1[nH]c2ccc(-c3c(F)cc(N4CCOCC4)cc3F)nc2c1F |
| InChI | InChI=1S/C23H22F3N3O5/c24-12-7-11(29-3-5-31-6-4-29)8-13(25)18(12)14-1-2-15-20(27-14)19(26)23(28-15)34-17-10-33-21-16(30)9-32-22(17)21/h1-2,7-8,16-17,21-22,28,30H,3-6,9-10H2/t16-,17-,21?,22?/m1/s1 |
| InChIKey | CAUSEYMCQZKBNU-WZGNDQMWSA-N |
| XLogP | 2.39 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |