C26H28F2N4O6S — CID 118285564
(3R,3aR,6R,6aR)-6-[[5-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118285564) has the molecular formula C26H28F2N4O6S and a molecular weight of 562.60 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[5-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[5-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118285564 |
| Molecular Formula | C26H28F2N4O6S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[5-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O=S(=O)(C1CC1)N1CCN(c2ccc(-c3c(F)cc4[nH]c(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)nc4c3F)cc2)CC1 |
| InChI | InChI=1S/C26H28F2N4O6S/c27-17-11-18-23(30-26(29-18)38-20-13-37-24-19(33)12-36-25(20)24)22(28)21(17)14-1-3-15(4-2-14)31-7-9-32(10-8-31)39(34,35)16-5-6-16/h1-4,11,16,19-20,24-25,33H,5-10,12-13H2,(H,29,30)/t19-,20-,24-,25-/m1/s1 |
| InChIKey | CODIHMVXBAOOFK-GQUJEBGOSA-N |
| XLogP | 2.03 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |