C13H11ClFIN2O4 — CID 118285496
(3R,3aS,6S,6aS)-6-[(6-chloro-4-fluoro-5-iodo-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118285496) has the molecular formula C13H11ClFIN2O4 and a molecular weight of 440.60 g/mol. Its IUPAC name is (3R,3aS,6S,6aS)-6-[(6-chloro-4-fluoro-5-iodo-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aS,6S,6aS)-6-[(6-chloro-4-fluoro-5-iodo-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118285496 |
| Molecular Formula | C13H11ClFIN2O4 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | (3R,3aS,6S,6aS)-6-[(6-chloro-4-fluoro-5-iodo-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@@H]2[C@H]1OC[C@@H]2Oc1nc2c(F)c(I)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C13H11ClFIN2O4/c14-4-1-5-10(8(15)9(4)16)18-13(17-5)22-7-3-21-11-6(19)2-20-12(7)11/h1,6-7,11-12,19H,2-3H2,(H,17,18)/t6-,7+,11+,12+/m1/s1 |
| InChIKey | KPVTZHMFYOMLHV-PFSXBIFSSA-N |
| XLogP | 1.87 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|