C16H15ClN4O5S — CID 144737384
(3R,6R)-6-[[6-chloro-5-(1,3-thiazol-5-ylmethoxy)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144737384) has the molecular formula C16H15ClN4O5S and a molecular weight of 410.84 g/mol. Its IUPAC name is (3R,6R)-6-[[6-chloro-5-(1,3-thiazol-5-ylmethoxy)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6R)-6-[[6-chloro-5-(1,3-thiazol-5-ylmethoxy)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144737384 |
| Molecular Formula | C16H15ClN4O5S |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (3R,6R)-6-[[6-chloro-5-(1,3-thiazol-5-ylmethoxy)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1COC2C1OC[C@H]2Oc1nc2nc(OCc3cncs3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H15ClN4O5S/c17-8-1-9-14(20-15(8)25-3-7-2-18-6-27-7)21-16(19-9)26-11-5-24-12-10(22)4-23-13(11)12/h1-2,6,10-13,22H,3-5H2,(H,19,20,21)/t10-,11-,12?,13?/m1/s1 |
| InChIKey | BIIISKUEAXBSMO-OKZRHMCRSA-N |
| XLogP | 1.55 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |