C22H17ClF2N4O5S — CID 144737618
(3R,6R)-6-[[6-chloro-5-[[2,6-difluoro-4-(1,3-thiazol-2-yl)phenyl]methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144737618) has the molecular formula C22H17ClF2N4O5S and a molecular weight of 522.92 g/mol. Its IUPAC name is (3R,6R)-6-[[6-chloro-5-[[2,6-difluoro-4-(1,3-thiazol-2-yl)phenyl]methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6R)-6-[[6-chloro-5-[[2,6-difluoro-4-(1,3-thiazol-2-yl)phenyl]methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144737618 |
| Molecular Formula | C22H17ClF2N4O5S |
| Molecular Weight | 522.92 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | (3R,6R)-6-[[6-chloro-5-[[2,6-difluoro-4-(1,3-thiazol-2-yl)phenyl]methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1COC2C1OC[C@H]2Oc1nc2nc(OCc3c(F)cc(-c4nccs4)cc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H17ClF2N4O5S/c23-11-5-14-19(29-22(27-14)34-16-8-32-17-15(30)7-31-18(16)17)28-20(11)33-6-10-12(24)3-9(4-13(10)25)21-26-1-2-35-21/h1-5,15-18,30H,6-8H2,(H,27,28,29)/t15-,16-,17?,18?/m1/s1 |
| InChIKey | RCCHGEXNRVSSSX-MRLCAUJQSA-N |
| XLogP | 3.50 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.92 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |