C19H16ClF2N3O5 — CID 144737793
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[(3,5-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144737793) has the molecular formula C19H16ClF2N3O5 and a molecular weight of 439.80 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(3,5-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(3,5-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144737793 |
| Molecular Formula | C19H16ClF2N3O5 |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(3,5-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(OCc3cc(F)cc(F)c3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H16ClF2N3O5/c20-11-4-12-17(24-18(11)29-5-8-1-9(21)3-10(22)2-8)25-19(23-12)30-14-7-28-15-13(26)6-27-16(14)15/h1-4,13-16,26H,5-7H2,(H,23,24,25)/t13-,14-,15-,16-/m1/s1 |
| InChIKey | SNYBSXLUKFONLN-KLHDSHLOSA-N |
| XLogP | 2.37 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |