C19H17ClFN3O5 — CID 144737641
(3R,6R,6aR)-6-[[6-chloro-5-[(2-fluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144737641) has the molecular formula C19H17ClFN3O5 and a molecular weight of 421.81 g/mol. Its IUPAC name is (3R,6R,6aR)-6-[[6-chloro-5-[(2-fluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6R,6aR)-6-[[6-chloro-5-[(2-fluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144737641 |
| Molecular Formula | C19H17ClFN3O5 |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (3R,6R,6aR)-6-[[6-chloro-5-[(2-fluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2C1OC[C@H]2Oc1nc2nc(OCc3ccccc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H17ClFN3O5/c20-10-5-12-17(23-18(10)28-6-9-3-1-2-4-11(9)21)24-19(22-12)29-14-8-27-15-13(25)7-26-16(14)15/h1-5,13-16,25H,6-8H2,(H,22,23,24)/t13-,14-,15?,16-/m1/s1 |
| InChIKey | PAOFKKKRNVCPQO-QRBDLBBESA-N |
| XLogP | 2.24 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |