C23H21Cl2F2N3O5 — CID 144737669
acetylene;(3R,6R)-6-[[6-chloro-5-[(4-chloro-2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethene (PubChem CID 144737669) has the molecular formula C23H21Cl2F2N3O5 and a molecular weight of 528.34 g/mol. Its IUPAC name is acetylene;(3R,6R)-6-[[6-chloro-5-[(4-chloro-2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethene.
| Compound Name | acetylene;(3R,6R)-6-[[6-chloro-5-[(4-chloro-2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethene |
|---|---|
| PubChem CID | 144737669 |
| Molecular Formula | C23H21Cl2F2N3O5 |
| Molecular Weight | 528.34 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | acetylene;(3R,6R)-6-[[6-chloro-5-[(4-chloro-2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethene |
| SMILES | C#C.C=C.O[C@@H]1COC2C1OC[C@H]2Oc1nc2nc(OCc3c(F)cc(Cl)cc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H15Cl2F2N3O5.C2H4.C2H2/c20-7-1-10(22)8(11(23)2-7)4-30-18-9(21)3-12-17(25-18)26-19(24-12)31-14-6-29-15-13(27)5-28-16(14)15;2*1-2/h1-3,13-16,27H,4-6H2,(H,24,25,26);1-2H2;1-2H/t13-,14-,15?,16?;;/m1../s1 |
| InChIKey | DHQXPNLLQIJJTB-GENBYUFGSA-N |
| XLogP | 4.08 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|