C19H16ClF2N3O6 — CID 144737428
(3R,6S,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,5-diol (PubChem CID 144737428) has the molecular formula C19H16ClF2N3O6 and a molecular weight of 455.80 g/mol. Its IUPAC name is (3R,6S,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,5-diol.
| Compound Name | (3R,6S,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,5-diol |
|---|---|
| PubChem CID | 144737428 |
| Molecular Formula | C19H16ClF2N3O6 |
| Molecular Weight | 455.80 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (3R,6S,6aS)-6-[[6-chloro-5-[(2,6-difluorophenyl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,5-diol |
| SMILES | OC1OC2[C@H](O)CO[C@@H]2[C@@H]1Oc1nc2nc(OCc3c(F)cccc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H16ClF2N3O6/c20-8-4-11-16(24-17(8)29-5-7-9(21)2-1-3-10(7)22)25-19(23-11)31-15-14-13(30-18(15)27)12(26)6-28-14/h1-4,12-15,18,26-27H,5-6H2,(H,23,24,25)/t12-,13?,14+,15+,18?/m1/s1 |
| InChIKey | ACNZRJWLJOFBDJ-MAKNJDEBSA-N |
| XLogP | 1.69 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.80 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |