C17H18ClN5O5 — CID 144737463
(3R,3aR,6R)-6-[[6-chloro-5-[(1-methylpyrazol-4-yl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144737463) has the molecular formula C17H18ClN5O5 and a molecular weight of 407.81 g/mol. Its IUPAC name is (3R,3aR,6R)-6-[[6-chloro-5-[(1-methylpyrazol-4-yl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R)-6-[[6-chloro-5-[(1-methylpyrazol-4-yl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144737463 |
| Molecular Formula | C17H18ClN5O5 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (3R,3aR,6R)-6-[[6-chloro-5-[(1-methylpyrazol-4-yl)methoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | Cn1cc(COc2nc3nc(O[C@@H]4CO[C@H]5C4OC[C@H]5O)[nH]c3cc2Cl)cn1 |
| InChI | InChI=1S/C17H18ClN5O5/c1-23-4-8(3-19-23)5-27-16-9(18)2-10-15(21-16)22-17(20-10)28-12-7-26-13-11(24)6-25-14(12)13/h2-4,11-14,24H,5-7H2,1H3,(H,20,21,22)/t11-,12-,13-,14?/m1/s1 |
| InChIKey | CKSGJATWMUWHEJ-ZHZAVPAVSA-N |
| XLogP | 0.83 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |