C19H19ClN4O4 — CID 118424697
(3R,3aR,6R,6aR)-6-[[6-chloro-5-(6-ethyl-3-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118424697) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-(6-ethyl-3-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(6-ethyl-3-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118424697 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(6-ethyl-3-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CCc1ccc(-c2nc3nc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2Cl)cn1 |
| InChI | InChI=1S/C19H19ClN4O4/c1-2-10-4-3-9(6-21-10)15-11(20)5-12-18(23-15)24-19(22-12)28-14-8-27-16-13(25)7-26-17(14)16/h3-6,13-14,16-17,25H,2,7-8H2,1H3,(H,22,23,24)/t13-,14-,16-,17-/m1/s1 |
| InChIKey | YFXMVRLBMJHLTC-MUIFIZLQSA-N |
| XLogP | 2.14 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |