C18H16ClIN4O4 — CID 176678669
(3aR,6aR)-6-[[6-chloro-5-[6-(iodomethyl)-3-pyridinyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 176678669) has the molecular formula C18H16ClIN4O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is (3aR,6aR)-6-[[6-chloro-5-[6-(iodomethyl)-3-pyridinyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3aR,6aR)-6-[[6-chloro-5-[6-(iodomethyl)-3-pyridinyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 176678669 |
| Molecular Formula | C18H16ClIN4O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 513.99 |
| IUPAC Name | (3aR,6aR)-6-[[6-chloro-5-[6-(iodomethyl)-3-pyridinyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | OC1CO[C@@H]2C(Oc3nc4nc(-c5ccc(CI)nc5)c(Cl)cc4[nH]3)CO[C@H]12 |
| InChI | InChI=1S/C18H16ClIN4O4/c19-10-3-11-17(23-14(10)8-1-2-9(4-20)21-5-8)24-18(22-11)28-13-7-27-15-12(25)6-26-16(13)15/h1-3,5,12-13,15-16,25H,4,6-7H2,(H,22,23,24)/t12?,13?,15-,16-/m1/s1 |
| InChIKey | ZDPKIQFEDVFMCU-BCAXMMLOSA-N |
| XLogP | 2.51 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|