C22H20ClN3O5 — CID 77465962
6-[[6-chloro-5-[4-(4-hydroxybut-1-ynyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 77465962) has the molecular formula C22H20ClN3O5 and a molecular weight of 441.87 g/mol. Its IUPAC name is 6-[[6-chloro-5-[4-(4-hydroxybut-1-ynyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | 6-[[6-chloro-5-[4-(4-hydroxybut-1-ynyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 77465962 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 6-[[6-chloro-5-[4-(4-hydroxybut-1-ynyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | OCCC#Cc1ccc(-c2nc3nc(OC4COC5C(O)COC45)[nH]c3cc2Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3O5/c23-14-9-15-21(25-18(14)13-6-4-12(5-7-13)3-1-2-8-27)26-22(24-15)31-17-11-30-19-16(28)10-29-20(17)19/h4-7,9,16-17,19-20,27-28H,2,8,10-11H2,(H,24,25,26) |
| InChIKey | ZLJLMSWXUPNMLT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|