C16H14ClN3O4S — CID 118424706
(3R,3aR,6R,6aR)-6-[(6-chloro-5-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118424706) has the molecular formula C16H14ClN3O4S and a molecular weight of 379.83 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[(6-chloro-5-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[(6-chloro-5-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118424706 |
| Molecular Formula | C16H14ClN3O4S |
| Molecular Weight | 379.83 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[(6-chloro-5-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(-c3ccsc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H14ClN3O4S/c17-8-3-9-15(19-12(8)7-1-2-25-6-7)20-16(18-9)24-11-5-23-13-10(21)4-22-14(11)13/h1-3,6,10-11,13-14,21H,4-5H2,(H,18,19,20)/t10-,11-,13-,14-/m1/s1 |
| InChIKey | RNAOCUBXSHMRQJ-HBJVGIJOSA-N |
| XLogP | 2.25 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.83 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |