C19H16ClN3O6 — CID 138508693
(3R,3aR,6R)-6-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 138508693) has the molecular formula C19H16ClN3O6 and a molecular weight of 417.81 g/mol. Its IUPAC name is (3R,3aR,6R)-6-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R)-6-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 138508693 |
| Molecular Formula | C19H16ClN3O6 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | (3R,3aR,6R)-6-[[5-(1,3-benzodioxol-5-yl)-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1COC2[C@H](Oc3nc4nc(-c5ccc6c(c5)OCO6)c(Cl)cc4[nH]3)CO[C@@H]21 |
| InChI | InChI=1S/C19H16ClN3O6/c20-9-4-10-18(22-15(9)8-1-2-12-13(3-8)28-7-27-12)23-19(21-10)29-14-6-26-16-11(24)5-25-17(14)16/h1-4,11,14,16-17,24H,5-7H2,(H,21,22,23)/t11-,14-,16-,17?/m1/s1 |
| InChIKey | QUTAHWCRFUWMIZ-GPESFRPYSA-N |
| XLogP | 1.91 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |