C22H18ClN5O4 — CID 176679112
(3R,3aR,6R,6aR)-6-[[6-chloro-5-(4-pyrazin-2-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 176679112) has the molecular formula C22H18ClN5O4 and a molecular weight of 451.87 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-(4-pyrazin-2-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(4-pyrazin-2-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 176679112 |
| Molecular Formula | C22H18ClN5O4 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-(4-pyrazin-2-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(-c3ccc(-c4cnccn4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H18ClN5O4/c23-13-7-14-21(28-22(26-14)32-17-10-31-19-16(29)9-30-20(17)19)27-18(13)12-3-1-11(2-4-12)15-8-24-5-6-25-15/h1-8,16-17,19-20,29H,9-10H2,(H,26,27,28)/t16-,17-,19-,20-/m1/s1 |
| InChIKey | FVZJCLOJKIFWFQ-HNBVOPMISA-N |
| XLogP | 2.64 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |