C20H23ClN4O6S — CID 144737566
5-[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxymethyl]thiophene-2-carbaldehyde;N-methylmethanamine (PubChem CID 144737566) has the molecular formula C20H23ClN4O6S and a molecular weight of 482.95 g/mol. Its IUPAC name is 5-[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxymethyl]thiophene-2-carbaldehyde;N-methylmethanamine.
| Compound Name | 5-[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxymethyl]thiophene-2-carbaldehyde;N-methylmethanamine |
|---|---|
| PubChem CID | 144737566 |
| Molecular Formula | C20H23ClN4O6S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 5-[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxymethyl]thiophene-2-carbaldehyde;N-methylmethanamine |
| SMILES | CNC.O=Cc1ccc(COc2nc3nc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2Cl)s1 |
| InChI | InChI=1S/C18H16ClN3O6S.C2H7N/c19-10-3-11-16(21-17(10)27-5-9-2-1-8(4-23)29-9)22-18(20-11)28-13-7-26-14-12(24)6-25-15(13)14;1-3-2/h1-4,12-15,24H,5-7H2,(H,20,21,22);3H,1-2H3/t12-,13-,14-,15-;/m1./s1 |
| InChIKey | GYERBXWYQKTSSK-JODQJINJSA-N |
| XLogP | 1.81 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|