C14H14F2N2O4 — CID 139505054
(3R,3aR,6R,6aR)-6-[(4,6-difluoro-5-methyl-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 139505054) has the molecular formula C14H14F2N2O4 and a molecular weight of 312.27 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[(4,6-difluoro-5-methyl-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[(4,6-difluoro-5-methyl-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 139505054 |
| Molecular Formula | C14H14F2N2O4 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[(4,6-difluoro-5-methyl-1H-benzimidazol-2-yl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | Cc1c(F)cc2[nH]c(O[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)nc2c1F |
| InChI | InChI=1S/C14H14F2N2O4/c1-5-6(15)2-7-11(10(5)16)18-14(17-7)22-9-4-21-12-8(19)3-20-13(9)12/h2,8-9,12-13,19H,3-4H2,1H3,(H,17,18)/t8-,9-,12-,13-/m1/s1 |
| InChIKey | XZIXCPMXQCICMV-NRMKKVEVSA-N |
| XLogP | 1.06 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |