C20H19ClF2N4O4 — CID 145072573
(3R,3aR,6R)-6-[[6-chloro-5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 145072573) has the molecular formula C20H19ClF2N4O4 and a molecular weight of 452.85 g/mol. Its IUPAC name is (3R,3aR,6R)-6-[[6-chloro-5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R)-6-[[6-chloro-5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 145072573 |
| Molecular Formula | C20H19ClF2N4O4 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (3R,3aR,6R)-6-[[6-chloro-5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[C@H](Nc1nc2nc(O[C@@H]3CO[C@H]4C3OC[C@H]4O)[nH]c2cc1Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C20H19ClF2N4O4/c1-8(15-10(22)3-2-4-11(15)23)24-18-9(21)5-12-19(26-18)27-20(25-12)31-14-7-30-16-13(28)6-29-17(14)16/h2-5,8,13-14,16-17,28H,6-7H2,1H3,(H2,24,25,26,27)/t8-,13+,14+,16+,17?/m0/s1 |
| InChIKey | ZSAKTPKEVMJOQZ-PTLYKDNESA-N |
| XLogP | 2.97 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |