C19H16ClFN4O5 — CID 145072597
N-[2-[[(3R,3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]-3-fluorobenzamide (PubChem CID 145072597) has the molecular formula C19H16ClFN4O5 and a molecular weight of 434.81 g/mol. Its IUPAC name is N-[2-[[(3R,3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]-3-fluorobenzamide.
| Compound Name | N-[2-[[(3R,3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 145072597 |
| Molecular Formula | C19H16ClFN4O5 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[2-[[(3R,3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]-3-fluorobenzamide |
| SMILES | O=C(Nc1nc2nc(O[C@@H]3CO[C@H]4C3OC[C@H]4O)[nH]c2cc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C19H16ClFN4O5/c20-10-5-11-17(23-16(10)24-18(27)8-2-1-3-9(21)4-8)25-19(22-11)30-13-7-29-14-12(26)6-28-15(13)14/h1-5,12-15,26H,6-7H2,(H2,22,23,24,25,27)/t12-,13-,14-,15?/m1/s1 |
| InChIKey | YTAKEZWYMVMJKW-CBNXCZCTSA-N |
| XLogP | 1.91 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |