C21H21ClN4O6 — CID 144737665
3-[[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxy]-N,N-dimethylbenzamide (PubChem CID 144737665) has the molecular formula C21H21ClN4O6 and a molecular weight of 460.87 g/mol. Its IUPAC name is 3-[[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 144737665 |
| Molecular Formula | C21H21ClN4O6 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 3-[[2-[[(3R,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]oxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Oc2nc3nc(O[C@@H]4COC5[C@H](O)CO[C@@H]54)[nH]c3cc2Cl)c1 |
| InChI | InChI=1S/C21H21ClN4O6/c1-26(2)20(28)10-4-3-5-11(6-10)31-19-12(22)7-13-18(24-19)25-21(23-13)32-15-9-30-16-14(27)8-29-17(15)16/h3-7,14-17,27H,8-9H2,1-2H3,(H,23,24,25)/t14-,15-,16?,17-/m1/s1 |
| InChIKey | BHPOKDRUHGQJAT-FRBBGCKASA-N |
| XLogP | 2.01 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |