C21H20ClN3O5 — CID 144737407
(3R,6R,6aR)-6-[[6-chloro-5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144737407) has the molecular formula C21H20ClN3O5 and a molecular weight of 429.86 g/mol. Its IUPAC name is (3R,6R,6aR)-6-[[6-chloro-5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6R,6aR)-6-[[6-chloro-5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144737407 |
| Molecular Formula | C21H20ClN3O5 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (3R,6R,6aR)-6-[[6-chloro-5-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2C1OC[C@H]2Oc1nc2nc(O[C@H]3CCc4ccccc43)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C21H20ClN3O5/c22-12-7-13-19(24-20(12)29-15-6-5-10-3-1-2-4-11(10)15)25-21(23-13)30-16-9-28-17-14(26)8-27-18(16)17/h1-4,7,14-18,26H,5-6,8-9H2,(H,23,24,25)/t14-,15+,16-,17?,18-/m1/s1 |
| InChIKey | NSRMDHLKOQPBSG-YUGHNKOSSA-N |
| XLogP | 2.58 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |