C19H15ClF3N3O5 — CID 144737752
(3R,3aR,6R)-6-[[6-chloro-5-[3-(trifluoromethyl)phenoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144737752) has the molecular formula C19H15ClF3N3O5 and a molecular weight of 457.79 g/mol. Its IUPAC name is (3R,3aR,6R)-6-[[6-chloro-5-[3-(trifluoromethyl)phenoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R)-6-[[6-chloro-5-[3-(trifluoromethyl)phenoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144737752 |
| Molecular Formula | C19H15ClF3N3O5 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (3R,3aR,6R)-6-[[6-chloro-5-[3-(trifluoromethyl)phenoxy]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1COC2[C@H](Oc3nc4nc(Oc5cccc(C(F)(F)F)c5)c(Cl)cc4[nH]3)CO[C@@H]21 |
| InChI | InChI=1S/C19H15ClF3N3O5/c20-10-5-11-16(25-17(10)30-9-3-1-2-8(4-9)19(21,22)23)26-18(24-11)31-13-7-29-14-12(27)6-28-15(13)14/h1-5,12-15,27H,6-7H2,(H,24,25,26)/t12-,13-,14-,15?/m1/s1 |
| InChIKey | JDGKFNLHJRCORM-CBNXCZCTSA-N |
| XLogP | 3.33 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |