C26H20ClF3N2O4 — CID 118285542
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[3-(trifluoromethyl)phenyl]phenyl]-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118285542) has the molecular formula C26H20ClF3N2O4 and a molecular weight of 516.90 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[3-(trifluoromethyl)phenyl]phenyl]-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[3-(trifluoromethyl)phenyl]phenyl]-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118285542 |
| Molecular Formula | C26H20ClF3N2O4 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-[3-(trifluoromethyl)phenyl]phenyl]-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2cc(-c3ccc(-c4cccc(C(F)(F)F)c4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C26H20ClF3N2O4/c27-18-10-20-19(31-25(32-20)36-22-12-35-23-21(33)11-34-24(22)23)9-17(18)14-6-4-13(5-7-14)15-2-1-3-16(8-15)26(28,29)30/h1-10,21-24,33H,11-12H2,(H,31,32)/t21-,22-,23-,24-/m1/s1 |
| InChIKey | KQFVEISCQCBMAS-MOUTVQLLSA-N |
| XLogP | 5.47 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |